| Names and Identifies |
| Product Name | 2,2-Dimethyl-1,3-propanediol |
| Synonyms | 1,3-Propanediol, 2,2-dimethyl-; Dimethylolpropane; Neopentanediol; Neopentylene glycol; 2,2-Dimethyl-1,3-propanediol; Dimethyltrimethylene glycol; Hydroxypivalyl alcohol; NPG; Neol; 1,3-Dihydroxy-2,2-dimethylpropane; 2,2-Dimethyl-1,3-dihydroxypropane; 2,2-Dimethylpropane-1,3-diol; NPG Glycol; 2,2-Dimethyltrimethylene glycol; NSC 55836 |
| CAS No. | 126-30-7 |
| EINECS | 204-781-0 |
| Inchi | InChI=1/C5H12O2/c1-2-5(3-6)4-7/h5-7H,2-4H2,1H3 |
| Short for Name | |
| Appearance | White crystle |
| Purity: | ≥99% |
| Physico-chemical Properties |
| Molecular Formula: | C5H12O2 |
| Molecular | 104.148 |
| Point of flammability | 107 °C |
| Density | -- |
| Flash point: | -- |
| Boiling point | -- |
| Melting point | 126-128 °C |
| Vapour pressure | -- |
| Solubility | -- |
| Refractive index | -- |
| Type | Dyestuff Intermediates |
| Stability: | Combustible |
| Packages and Capacity |
| Nornal pacakge | 25kgs/bag |
| MOQ | 1kg |
| Capactiy | 150MT/year |
| Application |
| 1,Neo Pentyl Glycol Mainly used in the manufacture of resins, plasticizers and surfactants 2,Neopentyl glycol has a wide range of uses, mainly as a plasticizer for the production of unsaturated polyester resins, oil-free alkyd resins, polyurethane foams and elastomers, additives for high-grade lubricants and other fine chemicals 3,NPG mainly used in Plasticizer. Organic Synthesis. Polyester synthetic raw materials |
| More Information |
| organic intermediate |